C11H13N3O — CID 170472996
4-(4,5-diamino-2-methylphenyl)but-3-ynamide (PubChem CID 170472996) has the molecular formula C11H13N3O and a molecular weight of 203.24 g/mol. Its IUPAC name is 4-(4,5-diamino-2-methylphenyl)but-3-ynamide.
| Compound Name | 4-(4,5-diamino-2-methylphenyl)but-3-ynamide |
|---|---|
| PubChem CID | 170472996 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 4-(4,5-diamino-2-methylphenyl)but-3-ynamide |
| SMILES | Cc1cc(N)c(N)cc1C#CCC(N)=O |
| InChI | InChI=1S/C11H13N3O/c1-7-5-9(12)10(13)6-8(7)3-2-4-11(14)15/h5-6H,4,12-13H2,1H3,(H2,14,15) |
| InChIKey | DYHKUQHVVBLWKS-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 95.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|