C10H12N4O — CID 170473161
4-(5,6-diamino-4-methyl-3-pyridinyl)but-3-ynamide (PubChem CID 170473161) has the molecular formula C10H12N4O and a molecular weight of 204.23 g/mol. Its IUPAC name is 4-(5,6-diamino-4-methyl-3-pyridinyl)but-3-ynamide.
| Compound Name | 4-(5,6-diamino-4-methyl-3-pyridinyl)but-3-ynamide |
|---|---|
| PubChem CID | 170473161 |
| Molecular Formula | C10H12N4O |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 4-(5,6-diamino-4-methyl-3-pyridinyl)but-3-ynamide |
| SMILES | Cc1c(C#CCC(N)=O)cnc(N)c1N |
| InChI | InChI=1S/C10H12N4O/c1-6-7(3-2-4-8(11)15)5-14-10(13)9(6)12/h5H,4,12H2,1H3,(H2,11,15)(H2,13,14) |
| InChIKey | JBJSBTUOBMPKLN-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 108.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|