C11H12N2O — CID 170472760
4-(3,5-dimethyl-2-pyridinyl)but-3-ynamide (PubChem CID 170472760) has the molecular formula C11H12N2O and a molecular weight of 188.23 g/mol. Its IUPAC name is 4-(3,5-dimethyl-2-pyridinyl)but-3-ynamide.
| Compound Name | 4-(3,5-dimethyl-2-pyridinyl)but-3-ynamide |
|---|---|
| PubChem CID | 170472760 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | 4-(3,5-dimethyl-2-pyridinyl)but-3-ynamide |
| SMILES | Cc1cnc(C#CCC(N)=O)c(C)c1 |
| InChI | InChI=1S/C11H12N2O/c1-8-6-9(2)10(13-7-8)4-3-5-11(12)14/h6-7H,5H2,1-2H3,(H2,12,14) |
| InChIKey | QEPMAKYFINPEAJ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|