C10H7Cl2NO — CID 170472586
4-(2,4-dichlorophenyl)but-3-ynamide (PubChem CID 170472586) has the molecular formula C10H7Cl2NO and a molecular weight of 228.08 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)but-3-ynamide.
| Compound Name | 4-(2,4-dichlorophenyl)but-3-ynamide |
|---|---|
| PubChem CID | 170472586 |
| Molecular Formula | C10H7Cl2NO |
| Molecular Weight | 228.08 g/mol |
| Exact Mass | 226.99 |
| IUPAC Name | 4-(2,4-dichlorophenyl)but-3-ynamide |
| SMILES | NC(=O)CC#Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C10H7Cl2NO/c11-8-5-4-7(9(12)6-8)2-1-3-10(13)14/h4-6H,3H2,(H2,13,14) |
| InChIKey | HLLHVLQNMFZXPL-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.08 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|