C8H3Cl3 — CID 57413219
2,4-dichloro-1-(2-chloroethynyl)benzene (PubChem CID 57413219) has the molecular formula C8H3Cl3 and a molecular weight of 205.47 g/mol. Its IUPAC name is 2,4-dichloro-1-(2-chloroethynyl)benzene.
| Compound Name | 2,4-dichloro-1-(2-chloroethynyl)benzene |
|---|---|
| PubChem CID | 57413219 |
| Molecular Formula | C8H3Cl3 |
| Molecular Weight | 205.47 g/mol |
| Exact Mass | 203.93 |
| IUPAC Name | 2,4-dichloro-1-(2-chloroethynyl)benzene |
| SMILES | ClC#Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C8H3Cl3/c9-4-3-6-1-2-7(10)5-8(6)11/h1-2,5H |
| InChIKey | APGCWGRHKRPJBT-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.47 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|