C9H5BrCl2 — CID 22927093
1-(3-bromoprop-1-ynyl)-2,4-dichlorobenzene (PubChem CID 22927093) has the molecular formula C9H5BrCl2 and a molecular weight of 263.95 g/mol. Its IUPAC name is 1-(3-bromoprop-1-ynyl)-2,4-dichlorobenzene.
| Compound Name | 1-(3-bromoprop-1-ynyl)-2,4-dichlorobenzene |
|---|---|
| PubChem CID | 22927093 |
| Molecular Formula | C9H5BrCl2 |
| Molecular Weight | 263.95 g/mol |
| Exact Mass | 261.90 |
| IUPAC Name | 1-(3-bromoprop-1-ynyl)-2,4-dichlorobenzene |
| SMILES | Clc1ccc(C#CCBr)c(Cl)c1 |
| InChI | InChI=1S/C9H5BrCl2/c10-5-1-2-7-3-4-8(11)6-9(7)12/h3-4,6H,5H2 |
| InChIKey | JPVDJQAQHSDFMV-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.95 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|