C18H15Cl2N — CID 68919281
2-[3-(2,4-dichlorophenyl)prop-2-ynyl]-3,4-dihydro-1H-isoquinoline (PubChem CID 68919281) has the molecular formula C18H15Cl2N and a molecular weight of 316.23 g/mol. Its IUPAC name is 2-[3-(2,4-dichlorophenyl)prop-2-ynyl]-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2-[3-(2,4-dichlorophenyl)prop-2-ynyl]-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 68919281 |
| Molecular Formula | C18H15Cl2N |
| Molecular Weight | 316.23 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 2-[3-(2,4-dichlorophenyl)prop-2-ynyl]-3,4-dihydro-1H-isoquinoline |
| SMILES | Clc1ccc(C#CCN2CCc3ccccc3C2)c(Cl)c1 |
| InChI | InChI=1S/C18H15Cl2N/c19-17-8-7-15(18(20)12-17)6-3-10-21-11-9-14-4-1-2-5-16(14)13-21/h1-2,4-5,7-8,12H,9-11,13H2 |
| InChIKey | ICOLNHOPZZGZBM-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.23 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|