C18H29N — CID 167466821
3-but-2-ynyl-1,2,4,5-tetrahydro-3-benzazepine;ethane (PubChem CID 167466821) has the molecular formula C18H29N and a molecular weight of 259.44 g/mol. Its IUPAC name is 3-but-2-ynyl-1,2,4,5-tetrahydro-3-benzazepine;ethane.
| Compound Name | 3-but-2-ynyl-1,2,4,5-tetrahydro-3-benzazepine;ethane |
|---|---|
| PubChem CID | 167466821 |
| Molecular Formula | C18H29N |
| Molecular Weight | 259.44 g/mol |
| Exact Mass | 259.23 |
| IUPAC Name | 3-but-2-ynyl-1,2,4,5-tetrahydro-3-benzazepine;ethane |
| SMILES | CC.CC.CC#CCN1CCc2ccccc2CC1 |
| InChI | InChI=1S/C14H17N.2C2H6/c1-2-3-10-15-11-8-13-6-4-5-7-14(13)9-12-15;2*1-2/h4-7H,8-12H2,1H3;2*1-2H3 |
| InChIKey | BSRPDYPRXCCPCR-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.44 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|