C11H15ClIN — CID 66610087
3-(chloromethyl)-1,2,4,5-tetrahydro-3-benzazepine;hydroiodide (PubChem CID 66610087) has the molecular formula C11H15ClIN and a molecular weight of 323.61 g/mol. Its IUPAC name is 3-(chloromethyl)-1,2,4,5-tetrahydro-3-benzazepine;hydroiodide.
| Compound Name | 3-(chloromethyl)-1,2,4,5-tetrahydro-3-benzazepine;hydroiodide |
|---|---|
| PubChem CID | 66610087 |
| Molecular Formula | C11H15ClIN |
| Molecular Weight | 323.61 g/mol |
| Exact Mass | 322.99 |
| IUPAC Name | 3-(chloromethyl)-1,2,4,5-tetrahydro-3-benzazepine;hydroiodide |
| SMILES | ClCN1CCc2ccccc2CC1.I |
| InChI | InChI=1S/C11H14ClN.HI/c12-9-13-7-5-10-3-1-2-4-11(10)6-8-13;/h1-4H,5-9H2;1H |
| InChIKey | YXNCGAWQWLOOPT-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.61 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|