C32H12Cl8Si — CID 154699158
tetrakis[2-(2,4-dichlorophenyl)ethynyl]silane (PubChem CID 154699158) has the molecular formula C32H12Cl8Si and a molecular weight of 708.16 g/mol. Its IUPAC name is tetrakis[2-(2,4-dichlorophenyl)ethynyl]silane.
| Compound Name | tetrakis[2-(2,4-dichlorophenyl)ethynyl]silane |
|---|---|
| PubChem CID | 154699158 |
| Molecular Formula | C32H12Cl8Si |
| Molecular Weight | 708.16 g/mol |
| Exact Mass | 703.82 |
| IUPAC Name | tetrakis[2-(2,4-dichlorophenyl)ethynyl]silane |
| SMILES | Clc1ccc(C#C[Si](C#Cc2ccc(Cl)cc2Cl)(C#Cc2ccc(Cl)cc2Cl)C#Cc2ccc(Cl)cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C32H12Cl8Si/c33-25-5-1-21(29(37)17-25)9-13-41(14-10-22-2-6-26(34)18-30(22)38,15-11-23-3-7-27(35)19-31(23)39)16-12-24-4-8-28(36)20-32(24)40/h1-8,17-20H |
| InChIKey | LYEGNVNRMNZBOR-UHFFFAOYSA-N |
| XLogP | 11.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.16 |
| LogP ≤ 5 | 11.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|