About 2-(4-chloro-2-fluorophenyl)ethynyl-trimethyl-λ4-sulfane
2-(4-chloro-2-fluorophenyl)ethynyl-trimethyl-λ4-sulfane (PubChem CID 134443610) has the molecular formula C11H12ClFS
and a molecular weight of 230.74 g/mol. Its IUPAC name is 2-(4-chloro-2-fluorophenyl)ethynyl-trimethyl-λ4-sulfane.
Molecular Properties
| Compound Name | 2-(4-chloro-2-fluorophenyl)ethynyl-trimethyl-λ4-sulfane |
| PubChem CID | 134443610 |
| Molecular Formula | C11H12ClFS |
| Molecular Weight | 230.74 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | 2-(4-chloro-2-fluorophenyl)ethynyl-trimethyl-λ4-sulfane |
| SMILES | CS(C)(C)C#Cc1ccc(Cl)cc1F |
| InChI | InChI=1S/C11H12ClFS/c1-14(2,3)7-6-9-4-5-10(12)8-11(9)13/h4-5,8H,1-3H3 |
| InChIKey | FEZKSQFHGSEGSU-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.74 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-chloro-2-fluorophenyl)ethynyl-trimethyl-λ4-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chloro-2-fluorophenyl)ethynyl-trimethyl-λ4-sulfane?
The IUPAC name of 2-(4-chloro-2-fluorophenyl)ethynyl-trimethyl-λ4-sulfane (CID 134443610) is 2-(4-chloro-2-fluorophenyl)ethynyl-trimethyl-λ4-sulfane.
What is the SMILES notation for 2-(4-chloro-2-fluorophenyl)ethynyl-trimethyl-λ4-sulfane?
The canonical SMILES for 2-(4-chloro-2-fluorophenyl)ethynyl-trimethyl-λ4-sulfane is CS(C)(C)C#Cc1ccc(Cl)cc1F.
What is the InChIKey of 2-(4-chloro-2-fluorophenyl)ethynyl-trimethyl-λ4-sulfane?
The InChIKey is FEZKSQFHGSEGSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12ClFS/c1-14(2,3)7-6-9-4-5-10(12)8-11(9)13/h4-5,8H,1-3H3.
What are the key properties of 2-(4-chloro-2-fluorophenyl)ethynyl-trimethyl-λ4-sulfane?
2-(4-chloro-2-fluorophenyl)ethynyl-trimethyl-λ4-sulfane has a molecular weight of 230.74 g/mol, XLogP of 3.48, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chloro-2-fluorophenyl)ethynyl-trimethyl-λ4-sulfane is sourced from PubChem (CID 134443610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).