C10H6ClF2NO — CID 170472850
4-(4-chloro-3,5-difluorophenyl)but-3-ynamide (PubChem CID 170472850) has the molecular formula C10H6ClF2NO and a molecular weight of 229.61 g/mol. Its IUPAC name is 4-(4-chloro-3,5-difluorophenyl)but-3-ynamide.
| Compound Name | 4-(4-chloro-3,5-difluorophenyl)but-3-ynamide |
|---|---|
| PubChem CID | 170472850 |
| Molecular Formula | C10H6ClF2NO |
| Molecular Weight | 229.61 g/mol |
| Exact Mass | 229.01 |
| IUPAC Name | 4-(4-chloro-3,5-difluorophenyl)but-3-ynamide |
| SMILES | NC(=O)CC#Cc1cc(F)c(Cl)c(F)c1 |
| InChI | InChI=1S/C10H6ClF2NO/c11-10-7(12)4-6(5-8(10)13)2-1-3-9(14)15/h4-5H,3H2,(H2,14,15) |
| InChIKey | PAKDCGFQAKABQB-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.61 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|