C9H6F2N2O — CID 170474131
4-(2,6-difluoro-4-pyridinyl)but-3-ynamide (PubChem CID 170474131) has the molecular formula C9H6F2N2O and a molecular weight of 196.16 g/mol. Its IUPAC name is 4-(2,6-difluoro-4-pyridinyl)but-3-ynamide.
| Compound Name | 4-(2,6-difluoro-4-pyridinyl)but-3-ynamide |
|---|---|
| PubChem CID | 170474131 |
| Molecular Formula | C9H6F2N2O |
| Molecular Weight | 196.16 g/mol |
| Exact Mass | 196.04 |
| IUPAC Name | 4-(2,6-difluoro-4-pyridinyl)but-3-ynamide |
| SMILES | NC(=O)CC#Cc1cc(F)nc(F)c1 |
| InChI | InChI=1S/C9H6F2N2O/c10-7-4-6(5-8(11)13-7)2-1-3-9(12)14/h4-5H,3H2,(H2,12,14) |
| InChIKey | SNYAVURQBCWACN-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.16 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|