C11H7F2NO3 — CID 170474174
5-(4-amino-4-oxobut-1-ynyl)-2,4-difluorobenzoic acid (PubChem CID 170474174) has the molecular formula C11H7F2NO3 and a molecular weight of 239.18 g/mol. Its IUPAC name is 5-(4-amino-4-oxobut-1-ynyl)-2,4-difluorobenzoic acid.
| Compound Name | 5-(4-amino-4-oxobut-1-ynyl)-2,4-difluorobenzoic acid |
|---|---|
| PubChem CID | 170474174 |
| Molecular Formula | C11H7F2NO3 |
| Molecular Weight | 239.18 g/mol |
| Exact Mass | 239.04 |
| IUPAC Name | 5-(4-amino-4-oxobut-1-ynyl)-2,4-difluorobenzoic acid |
| SMILES | NC(=O)CC#Cc1cc(C(=O)O)c(F)cc1F |
| InChI | InChI=1S/C11H7F2NO3/c12-8-5-9(13)7(11(16)17)4-6(8)2-1-3-10(14)15/h4-5H,3H2,(H2,14,15)(H,16,17) |
| InChIKey | CINXAIRQACBZBM-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.18 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|