C7H4Br3I — CID 164893725
1,2,5-tribromo-4-iodo-3-methylbenzene (PubChem CID 164893725) has the molecular formula C7H4Br3I and a molecular weight of 454.73 g/mol. Its IUPAC name is 1,2,5-tribromo-4-iodo-3-methylbenzene.
| Compound Name | 1,2,5-tribromo-4-iodo-3-methylbenzene |
|---|---|
| PubChem CID | 164893725 |
| Molecular Formula | C7H4Br3I |
| Molecular Weight | 454.73 g/mol |
| Exact Mass | 451.69 |
| IUPAC Name | 1,2,5-tribromo-4-iodo-3-methylbenzene |
| SMILES | Cc1c(Br)c(Br)cc(Br)c1I |
| InChI | InChI=1S/C7H4Br3I/c1-3-6(10)4(8)2-5(9)7(3)11/h2H,1H3 |
| InChIKey | RPVQQLUIHKHTJM-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.73 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|