C11H8Br2I2N2 — CID 160633625
3,5-dibromo-4-methylpyridine;3,5-diiodopyridine (PubChem CID 160633625) has the molecular formula C11H8Br2I2N2 and a molecular weight of 581.82 g/mol. Its IUPAC name is 3,5-dibromo-4-methylpyridine;3,5-diiodopyridine.
| Compound Name | 3,5-dibromo-4-methylpyridine;3,5-diiodopyridine |
|---|---|
| PubChem CID | 160633625 |
| Molecular Formula | C11H8Br2I2N2 |
| Molecular Weight | 581.82 g/mol |
| Exact Mass | 579.71 |
| IUPAC Name | 3,5-dibromo-4-methylpyridine;3,5-diiodopyridine |
| SMILES | Cc1c(Br)cncc1Br.Ic1cncc(I)c1 |
| InChI | InChI=1S/C6H5Br2N.C5H3I2N/c1-4-5(7)2-9-3-6(4)8;6-4-1-5(7)3-8-2-4/h2-3H,1H3;1-3H |
| InChIKey | RIFZAVCAHQEALG-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.82 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|