C8H8Br2O — CID 13108684
3,5-dibromo-2,6-dimethylphenol (PubChem CID 13108684) has the molecular formula C8H8Br2O and a molecular weight of 279.96 g/mol. Its IUPAC name is 3,5-dibromo-2,6-dimethylphenol.
| Compound Name | 3,5-dibromo-2,6-dimethylphenol |
|---|---|
| PubChem CID | 13108684 |
| Molecular Formula | C8H8Br2O |
| Molecular Weight | 279.96 g/mol |
| Exact Mass | 277.89 |
| IUPAC Name | 3,5-dibromo-2,6-dimethylphenol |
| SMILES | Cc1c(Br)cc(Br)c(C)c1O |
| InChI | InChI=1S/C8H8Br2O/c1-4-6(9)3-7(10)5(2)8(4)11/h3,11H,1-2H3 |
| InChIKey | ICXXAMGKHCPJSR-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.96 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |