C10H15BrO — CID 142823645
3-bromo-2,6-dimethylphenol;ethane (PubChem CID 142823645) has the molecular formula C10H15BrO and a molecular weight of 231.13 g/mol. Its IUPAC name is 3-bromo-2,6-dimethylphenol;ethane.
| Compound Name | 3-bromo-2,6-dimethylphenol;ethane |
|---|---|
| PubChem CID | 142823645 |
| Molecular Formula | C10H15BrO |
| Molecular Weight | 231.13 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | 3-bromo-2,6-dimethylphenol;ethane |
| SMILES | CC.Cc1ccc(Br)c(C)c1O |
| InChI | InChI=1S/C8H9BrO.C2H6/c1-5-3-4-7(9)6(2)8(5)10;1-2/h3-4,10H,1-2H3;1-2H3 |
| InChIKey | NYMJRHVEQWLKGX-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.13 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |