C9H10Br2 — CID 131618742
1-bromo-3-(bromomethyl)-2,4-dimethylbenzene (PubChem CID 131618742) has the molecular formula C9H10Br2 and a molecular weight of 277.99 g/mol. Its IUPAC name is 1-bromo-3-(bromomethyl)-2,4-dimethylbenzene.
| Compound Name | 1-bromo-3-(bromomethyl)-2,4-dimethylbenzene |
|---|---|
| PubChem CID | 131618742 |
| Molecular Formula | C9H10Br2 |
| Molecular Weight | 277.99 g/mol |
| Exact Mass | 275.91 |
| IUPAC Name | 1-bromo-3-(bromomethyl)-2,4-dimethylbenzene |
| SMILES | Cc1ccc(Br)c(C)c1CBr |
| InChI | InChI=1S/C9H10Br2/c1-6-3-4-9(11)7(2)8(6)5-10/h3-4H,5H2,1-2H3 |
| InChIKey | SSNJMLVEPPBZEY-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.99 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|