C8H7Br2Cl — CID 171002958
1,2-dibromo-3-(chloromethyl)-4-methylbenzene (PubChem CID 171002958) has the molecular formula C8H7Br2Cl and a molecular weight of 298.41 g/mol. Its IUPAC name is 1,2-dibromo-3-(chloromethyl)-4-methylbenzene.
| Compound Name | 1,2-dibromo-3-(chloromethyl)-4-methylbenzene |
|---|---|
| PubChem CID | 171002958 |
| Molecular Formula | C8H7Br2Cl |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 295.86 |
| IUPAC Name | 1,2-dibromo-3-(chloromethyl)-4-methylbenzene |
| SMILES | Cc1ccc(Br)c(Br)c1CCl |
| InChI | InChI=1S/C8H7Br2Cl/c1-5-2-3-7(9)8(10)6(5)4-11/h2-3H,4H2,1H3 |
| InChIKey | KWWYTAXBKTWJHV-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|