C8H8Br2O — CID 54359469
1,2-dibromo-3-methoxy-4-methylbenzene (PubChem CID 54359469) has the molecular formula C8H8Br2O and a molecular weight of 279.96 g/mol. Its IUPAC name is 1,2-dibromo-3-methoxy-4-methylbenzene.
| Compound Name | 1,2-dibromo-3-methoxy-4-methylbenzene |
|---|---|
| PubChem CID | 54359469 |
| Molecular Formula | C8H8Br2O |
| Molecular Weight | 279.96 g/mol |
| Exact Mass | 277.89 |
| IUPAC Name | 1,2-dibromo-3-methoxy-4-methylbenzene |
| SMILES | COc1c(C)ccc(Br)c1Br |
| InChI | InChI=1S/C8H8Br2O/c1-5-3-4-6(9)7(10)8(5)11-2/h3-4H,1-2H3 |
| InChIKey | ULMAXYRLIWYMHF-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.96 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |