About 2-bromo-1,3,5-triiodobenzene
2-bromo-1,3,5-triiodobenzene (PubChem CID 71168194) has the molecular formula C6H2BrI3
and a molecular weight of 534.70 g/mol. Its IUPAC name is 2-bromo-1,3,5-triiodobenzene.
Molecular Properties
| Compound Name | 2-bromo-1,3,5-triiodobenzene |
| PubChem CID | 71168194 |
| Molecular Formula | C6H2BrI3 |
| Molecular Weight | 534.70 g/mol |
| Exact Mass | 533.65 |
| IUPAC Name | 2-bromo-1,3,5-triiodobenzene |
| SMILES | Brc1c(I)cc(I)cc1I |
| InChI | InChI=1S/C6H2BrI3/c7-6-4(9)1-3(8)2-5(6)10/h1-2H |
| InChIKey | FUKQJMZKQJVSMW-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 534.70 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-1,3,5-triiodobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-1,3,5-triiodobenzene?
The IUPAC name of 2-bromo-1,3,5-triiodobenzene (CID 71168194) is 2-bromo-1,3,5-triiodobenzene.
What is the SMILES notation for 2-bromo-1,3,5-triiodobenzene?
The canonical SMILES for 2-bromo-1,3,5-triiodobenzene is Brc1c(I)cc(I)cc1I.
What is the InChIKey of 2-bromo-1,3,5-triiodobenzene?
The InChIKey is FUKQJMZKQJVSMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2BrI3/c7-6-4(9)1-3(8)2-5(6)10/h1-2H.
What are the key properties of 2-bromo-1,3,5-triiodobenzene?
2-bromo-1,3,5-triiodobenzene has a molecular weight of 534.70 g/mol, XLogP of 4.26, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-1,3,5-triiodobenzene is sourced from PubChem (CID 71168194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).