C6H2Br3I — CID 119023408
1,2,4-tribromo-3-iodobenzene (PubChem CID 119023408) has the molecular formula C6H2Br3I and a molecular weight of 440.70 g/mol. Its IUPAC name is 1,2,4-tribromo-3-iodobenzene.
| Compound Name | 1,2,4-tribromo-3-iodobenzene |
|---|---|
| PubChem CID | 119023408 |
| Molecular Formula | C6H2Br3I |
| Molecular Weight | 440.70 g/mol |
| Exact Mass | 437.68 |
| IUPAC Name | 1,2,4-tribromo-3-iodobenzene |
| SMILES | Brc1ccc(Br)c(I)c1Br |
| InChI | InChI=1S/C6H2Br3I/c7-3-1-2-4(8)6(10)5(3)9/h1-2H |
| InChIKey | IPVWIGSBBCCQIH-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.70 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|