C6H2Br3O- — CID 18781512
2,3,4-tribromophenolate (PubChem CID 18781512) has the molecular formula C6H2Br3O- and a molecular weight of 329.79 g/mol. Its IUPAC name is 2,3,4-tribromophenolate.
| Compound Name | 2,3,4-tribromophenolate |
|---|---|
| PubChem CID | 18781512 |
| Molecular Formula | C6H2Br3O- |
| Molecular Weight | 329.79 g/mol |
| Exact Mass | 326.77 |
| IUPAC Name | 2,3,4-tribromophenolate |
| SMILES | [O-]c1ccc(Br)c(Br)c1Br |
| InChI | InChI=1S/C6H3Br3O/c7-3-1-2-4(10)6(9)5(3)8/h1-2,10H/p-1 |
| InChIKey | OUCSIUCEQVCDEL-UHFFFAOYSA-M |
| XLogP | 3.05 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.79 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|