C7H5BBr4O3 — CID 175456800
bromo methyl (2,3,4-tribromophenyl) borate (PubChem CID 175456800) has the molecular formula C7H5BBr4O3 and a molecular weight of 467.54 g/mol. Its IUPAC name is bromo methyl (2,3,4-tribromophenyl) borate.
| Compound Name | bromo methyl (2,3,4-tribromophenyl) borate |
|---|---|
| PubChem CID | 175456800 |
| Molecular Formula | C7H5BBr4O3 |
| Molecular Weight | 467.54 g/mol |
| Exact Mass | 463.71 |
| IUPAC Name | bromo methyl (2,3,4-tribromophenyl) borate |
| SMILES | COB(OBr)Oc1ccc(Br)c(Br)c1Br |
| InChI | InChI=1S/C7H5BBr4O3/c1-13-8(15-12)14-5-3-2-4(9)6(10)7(5)11/h2-3H,1H3 |
| InChIKey | MZNYOXJDLINUED-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.54 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|