(E)-2,3-bis(2,3,4-tribromophenoxy)but-2-enedioic acid

C16H6Br6O6 — CID 21396886

IUPAC(E)-2,3-bis(2,3,4-tribromophenoxy)but-2-enedioic acid
SMILESO=C(O)/C(Oc1ccc(Br)c(Br)c1Br)=C(\Oc1ccc(Br)c(Br)c1Br)C(=O)O
InChIInChI=1S/C16H6Br6O6/c17-5-1-3-7(11(21)9(5)19)27-13(15(23)24)14(16(25)26)28-8-4-2-6(18)10(20)12(8)22/h1-4H,(H,23,24)(H,25,26)/b14-13+
InChIKeyXRMBLUNSAJRHFW-BUHFOSPRSA-N
MW773.64 g/mol
LogP7.10
Rot. Bonds6

About (E)-2,3-bis(2,3,4-tribromophenoxy)but-2-enedioic acid

(E)-2,3-bis(2,3,4-tribromophenoxy)but-2-enedioic acid (PubChem CID 21396886) has the molecular formula C16H6Br6O6 and a molecular weight of 773.64 g/mol. Its IUPAC name is (E)-2,3-bis(2,3,4-tribromophenoxy)but-2-enedioic acid.

Molecular Properties

Compound Name(E)-2,3-bis(2,3,4-tribromophenoxy)but-2-enedioic acid
PubChem CID21396886
Molecular FormulaC16H6Br6O6
Molecular Weight773.64 g/mol
Exact Mass767.53
IUPAC Name(E)-2,3-bis(2,3,4-tribromophenoxy)but-2-enedioic acid
SMILESO=C(O)/C(Oc1ccc(Br)c(Br)c1Br)=C(\Oc1ccc(Br)c(Br)c1Br)C(=O)O
InChIInChI=1S/C16H6Br6O6/c17-5-1-3-7(11(21)9(5)19)27-13(15(23)24)14(16(25)26)28-8-4-2-6(18)10(20)12(8)22/h1-4H,(H,23,24)(H,25,26)/b14-13+
InChIKeyXRMBLUNSAJRHFW-BUHFOSPRSA-N
XLogP7.10
TPSA93.06 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms28
Complexity

Lipinski Rule of Five

2 violations

RuleValue
MW ≤ 500773.64
LogP ≤ 57.10
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (E)-2,3-bis(2,3,4-tribromophenoxy)but-2-enedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-2,3-bis(2,3,4-tribromophenoxy)but-2-enedioic acid?
The IUPAC name of (E)-2,3-bis(2,3,4-tribromophenoxy)but-2-enedioic acid (CID 21396886) is (E)-2,3-bis(2,3,4-tribromophenoxy)but-2-enedioic acid.
What is the SMILES notation for (E)-2,3-bis(2,3,4-tribromophenoxy)but-2-enedioic acid?
The canonical SMILES for (E)-2,3-bis(2,3,4-tribromophenoxy)but-2-enedioic acid is O=C(O)/C(Oc1ccc(Br)c(Br)c1Br)=C(\Oc1ccc(Br)c(Br)c1Br)C(=O)O.
What is the InChIKey of (E)-2,3-bis(2,3,4-tribromophenoxy)but-2-enedioic acid?
The InChIKey is XRMBLUNSAJRHFW-BUHFOSPRSA-N. The full InChI is InChI=1S/C16H6Br6O6/c17-5-1-3-7(11(21)9(5)19)27-13(15(23)24)14(16(25)26)28-8-4-2-6(18)10(20)12(8)22/h1-4H,(H,23,24)(H,25,26)/b14-13+.
What are the key properties of (E)-2,3-bis(2,3,4-tribromophenoxy)but-2-enedioic acid?
(E)-2,3-bis(2,3,4-tribromophenoxy)but-2-enedioic acid has a molecular weight of 773.64 g/mol, XLogP of 7.10, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2,3-bis(2,3,4-tribromophenoxy)but-2-enedioic acid is sourced from PubChem (CID 21396886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).