C16H6Br6O6 — CID 21396886
(E)-2,3-bis(2,3,4-tribromophenoxy)but-2-enedioic acid (PubChem CID 21396886) has the molecular formula C16H6Br6O6 and a molecular weight of 773.64 g/mol. Its IUPAC name is (E)-2,3-bis(2,3,4-tribromophenoxy)but-2-enedioic acid.
| Compound Name | (E)-2,3-bis(2,3,4-tribromophenoxy)but-2-enedioic acid |
|---|---|
| PubChem CID | 21396886 |
| Molecular Formula | C16H6Br6O6 |
| Molecular Weight | 773.64 g/mol |
| Exact Mass | 767.53 |
| IUPAC Name | (E)-2,3-bis(2,3,4-tribromophenoxy)but-2-enedioic acid |
| SMILES | O=C(O)/C(Oc1ccc(Br)c(Br)c1Br)=C(\Oc1ccc(Br)c(Br)c1Br)C(=O)O |
| InChI | InChI=1S/C16H6Br6O6/c17-5-1-3-7(11(21)9(5)19)27-13(15(23)24)14(16(25)26)28-8-4-2-6(18)10(20)12(8)22/h1-4H,(H,23,24)(H,25,26)/b14-13+ |
| InChIKey | XRMBLUNSAJRHFW-BUHFOSPRSA-N |
| XLogP | 7.10 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.64 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|