C16H7Br6NO3 — CID 173205307
4-amino-4-oxo-2,3-bis(2,3,4-tribromophenyl)but-2-enoic acid (PubChem CID 173205307) has the molecular formula C16H7Br6NO3 and a molecular weight of 740.66 g/mol. Its IUPAC name is 4-amino-4-oxo-2,3-bis(2,3,4-tribromophenyl)but-2-enoic acid.
| Compound Name | 4-amino-4-oxo-2,3-bis(2,3,4-tribromophenyl)but-2-enoic acid |
|---|---|
| PubChem CID | 173205307 |
| Molecular Formula | C16H7Br6NO3 |
| Molecular Weight | 740.66 g/mol |
| Exact Mass | 734.55 |
| IUPAC Name | 4-amino-4-oxo-2,3-bis(2,3,4-tribromophenyl)but-2-enoic acid |
| SMILES | NC(=O)C(=C(C(=O)O)c1ccc(Br)c(Br)c1Br)c1ccc(Br)c(Br)c1Br |
| InChI | InChI=1S/C16H7Br6NO3/c17-7-3-1-5(11(19)13(7)21)9(15(23)24)10(16(25)26)6-2-4-8(18)14(22)12(6)20/h1-4H,(H2,23,24)(H,25,26) |
| InChIKey | WWAVJRDZWRIDOJ-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.66 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|