2,4-dibromo-3-hydroxybenzoic acid

C7H4Br2O3 — CID 14851210

IUPAC2,4-dibromo-3-hydroxybenzoic acid
SMILESO=C(O)c1ccc(Br)c(O)c1Br
InChIInChI=1S/C7H4Br2O3/c8-4-2-1-3(7(11)12)5(9)6(4)10/h1-2,10H,(H,11,12)
InChIKeyFZCONYDEKWEWDC-UHFFFAOYSA-N
MW295.91 g/mol
LogP2.62
Rot. Bonds1

About 2,4-dibromo-3-hydroxybenzoic acid

2,4-dibromo-3-hydroxybenzoic acid (PubChem CID 14851210) has the molecular formula C7H4Br2O3 and a molecular weight of 295.91 g/mol. Its IUPAC name is 2,4-dibromo-3-hydroxybenzoic acid.

Molecular Properties

Compound Name2,4-dibromo-3-hydroxybenzoic acid
PubChem CID14851210
Molecular FormulaC7H4Br2O3
Molecular Weight295.91 g/mol
Exact Mass293.85
IUPAC Name2,4-dibromo-3-hydroxybenzoic acid
SMILESO=C(O)c1ccc(Br)c(O)c1Br
InChIInChI=1S/C7H4Br2O3/c8-4-2-1-3(7(11)12)5(9)6(4)10/h1-2,10H,(H,11,12)
InChIKeyFZCONYDEKWEWDC-UHFFFAOYSA-N
XLogP2.62
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500295.91
LogP ≤ 52.62
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2,4-dibromo-3-hydroxybenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

4-bromo-3-hydroxy-2-(nitromethyl)benzoic acid
CID 174632102
3-bromo-2-hydroxybenzoic acid
CID 520927
3-bromo-2,4-dihydroxybenzoic acid
CID 90007527
2-(4-bromo-2,3-dihydroxyphenyl)-2-oxoacetic acid
CID 117406297
2-[(1R)-1-amino-2,2-difluoroethyl]-4-bromo-3-hydroxybenzoic acid
CID 131421519
ethoxyethane;2,3,4-tribromobenzoic acid
CID 67917078
3-amino-2-bromo-4-hydroxybenzoic acid
CID 84695246
3-bromo-4-chloro-2-hydroxybenzoic acid
CID 131396911
2-[(2R)-azetidin-2-yl]-4-bromo-3-hydroxybenzoic acid
CID 131498459
2-bromo-3,4-dimethylbenzoic acid
CID 20520739
sodium;2,3-dihydroxyterephthalic acid;hydride
CID 175464540
3,4-dibromo-2-methoxybenzoic acid
CID 171002402

Frequently Asked Questions

What is the IUPAC name of 2,4-dibromo-3-hydroxybenzoic acid?
The IUPAC name of 2,4-dibromo-3-hydroxybenzoic acid (CID 14851210) is 2,4-dibromo-3-hydroxybenzoic acid.
What is the SMILES notation for 2,4-dibromo-3-hydroxybenzoic acid?
The canonical SMILES for 2,4-dibromo-3-hydroxybenzoic acid is O=C(O)c1ccc(Br)c(O)c1Br.
What is the InChIKey of 2,4-dibromo-3-hydroxybenzoic acid?
The InChIKey is FZCONYDEKWEWDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4Br2O3/c8-4-2-1-3(7(11)12)5(9)6(4)10/h1-2,10H,(H,11,12).
What are the key properties of 2,4-dibromo-3-hydroxybenzoic acid?
2,4-dibromo-3-hydroxybenzoic acid has a molecular weight of 295.91 g/mol, XLogP of 2.62, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dibromo-3-hydroxybenzoic acid is sourced from PubChem (CID 14851210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).