C9H8BrF2NO3 — CID 131421519
2-[(1R)-1-amino-2,2-difluoroethyl]-4-bromo-3-hydroxybenzoic acid (PubChem CID 131421519) has the molecular formula C9H8BrF2NO3 and a molecular weight of 296.07 g/mol. Its IUPAC name is 2-[(1R)-1-amino-2,2-difluoroethyl]-4-bromo-3-hydroxybenzoic acid.
| Compound Name | 2-[(1R)-1-amino-2,2-difluoroethyl]-4-bromo-3-hydroxybenzoic acid |
|---|---|
| PubChem CID | 131421519 |
| Molecular Formula | C9H8BrF2NO3 |
| Molecular Weight | 296.07 g/mol |
| Exact Mass | 294.97 |
| IUPAC Name | 2-[(1R)-1-amino-2,2-difluoroethyl]-4-bromo-3-hydroxybenzoic acid |
| SMILES | N[C@H](c1c(C(=O)O)ccc(Br)c1O)C(F)F |
| InChI | InChI=1S/C9H8BrF2NO3/c10-4-2-1-3(9(15)16)5(7(4)14)6(13)8(11)12/h1-2,6,8,14H,13H2,(H,15,16)/t6-/m1/s1 |
| InChIKey | DPTXMKDPBNBJNG-ZCFIWIBFSA-N |
| XLogP | 2.12 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.07 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|