C10H12BrNO4 — CID 171257975
3-[(1R)-1-amino-3-hydroxypropyl]-4-bromo-2-hydroxybenzoic acid (PubChem CID 171257975) has the molecular formula C10H12BrNO4 and a molecular weight of 290.11 g/mol. Its IUPAC name is 3-[(1R)-1-amino-3-hydroxypropyl]-4-bromo-2-hydroxybenzoic acid.
| Compound Name | 3-[(1R)-1-amino-3-hydroxypropyl]-4-bromo-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 171257975 |
| Molecular Formula | C10H12BrNO4 |
| Molecular Weight | 290.11 g/mol |
| Exact Mass | 288.99 |
| IUPAC Name | 3-[(1R)-1-amino-3-hydroxypropyl]-4-bromo-2-hydroxybenzoic acid |
| SMILES | N[C@H](CCO)c1c(Br)ccc(C(=O)O)c1O |
| InChI | InChI=1S/C10H12BrNO4/c11-6-2-1-5(10(15)16)9(14)8(6)7(12)3-4-13/h1-2,7,13-14H,3-4,12H2,(H,15,16)/t7-/m1/s1 |
| InChIKey | VBKKKFOBFYSKKI-SSDOTTSWSA-N |
| XLogP | 1.24 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.11 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|