C11H12BrNO3 — CID 171254630
3-[(1S)-1-aminobut-3-enyl]-4-bromo-2-hydroxybenzoic acid (PubChem CID 171254630) has the molecular formula C11H12BrNO3 and a molecular weight of 286.12 g/mol. Its IUPAC name is 3-[(1S)-1-aminobut-3-enyl]-4-bromo-2-hydroxybenzoic acid.
| Compound Name | 3-[(1S)-1-aminobut-3-enyl]-4-bromo-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 171254630 |
| Molecular Formula | C11H12BrNO3 |
| Molecular Weight | 286.12 g/mol |
| Exact Mass | 285.00 |
| IUPAC Name | 3-[(1S)-1-aminobut-3-enyl]-4-bromo-2-hydroxybenzoic acid |
| SMILES | C=CC[C@H](N)c1c(Br)ccc(C(=O)O)c1O |
| InChI | InChI=1S/C11H12BrNO3/c1-2-3-8(13)9-7(12)5-4-6(10(9)14)11(15)16/h2,4-5,8,14H,1,3,13H2,(H,15,16)/t8-/m0/s1 |
| InChIKey | DOKQYBFREFUUJM-QMMMGPOBSA-N |
| XLogP | 2.43 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.12 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|