C11H12BrClF3NO — CID 171255695
2-[(1S)-1-aminobut-3-enyl]-6-bromo-3-(trifluoromethyl)phenol;hydrochloride (PubChem CID 171255695) has the molecular formula C11H12BrClF3NO and a molecular weight of 346.57 g/mol. Its IUPAC name is 2-[(1S)-1-aminobut-3-enyl]-6-bromo-3-(trifluoromethyl)phenol;hydrochloride.
| Compound Name | 2-[(1S)-1-aminobut-3-enyl]-6-bromo-3-(trifluoromethyl)phenol;hydrochloride |
|---|---|
| PubChem CID | 171255695 |
| Molecular Formula | C11H12BrClF3NO |
| Molecular Weight | 346.57 g/mol |
| Exact Mass | 344.97 |
| IUPAC Name | 2-[(1S)-1-aminobut-3-enyl]-6-bromo-3-(trifluoromethyl)phenol;hydrochloride |
| SMILES | C=CC[C@H](N)c1c(C(F)(F)F)ccc(Br)c1O.Cl |
| InChI | InChI=1S/C11H11BrF3NO.ClH/c1-2-3-8(16)9-6(11(13,14)15)4-5-7(12)10(9)17;/h2,4-5,8,17H,1,3,16H2;1H/t8-;/m0./s1 |
| InChIKey | ZPXZUMMNAMODNF-QRPNPIFTSA-N |
| XLogP | 4.17 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.57 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|