C10H14BrClN2O — CID 171256416
6-amino-2-[(1R)-1-aminobut-3-enyl]-3-bromophenol;hydrochloride (PubChem CID 171256416) has the molecular formula C10H14BrClN2O and a molecular weight of 293.59 g/mol. Its IUPAC name is 6-amino-2-[(1R)-1-aminobut-3-enyl]-3-bromophenol;hydrochloride.
| Compound Name | 6-amino-2-[(1R)-1-aminobut-3-enyl]-3-bromophenol;hydrochloride |
|---|---|
| PubChem CID | 171256416 |
| Molecular Formula | C10H14BrClN2O |
| Molecular Weight | 293.59 g/mol |
| Exact Mass | 292.00 |
| IUPAC Name | 6-amino-2-[(1R)-1-aminobut-3-enyl]-3-bromophenol;hydrochloride |
| SMILES | C=CC[C@@H](N)c1c(Br)ccc(N)c1O.Cl |
| InChI | InChI=1S/C10H13BrN2O.ClH/c1-2-3-7(12)9-6(11)4-5-8(13)10(9)14;/h2,4-5,7,14H,1,3,12-13H2;1H/t7-;/m1./s1 |
| InChIKey | SYUPOKINZWUVBX-OGFXRTJISA-N |
| XLogP | 2.73 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.59 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|