C10H13BrN2O3 — CID 171253064
methyl (3S)-3-amino-3-(3-amino-6-bromo-2-hydroxyphenyl)propanoate (PubChem CID 171253064) has the molecular formula C10H13BrN2O3 and a molecular weight of 289.13 g/mol. Its IUPAC name is methyl (3S)-3-amino-3-(3-amino-6-bromo-2-hydroxyphenyl)propanoate.
| Compound Name | methyl (3S)-3-amino-3-(3-amino-6-bromo-2-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 171253064 |
| Molecular Formula | C10H13BrN2O3 |
| Molecular Weight | 289.13 g/mol |
| Exact Mass | 288.01 |
| IUPAC Name | methyl (3S)-3-amino-3-(3-amino-6-bromo-2-hydroxyphenyl)propanoate |
| SMILES | COC(=O)C[C@H](N)c1c(Br)ccc(N)c1O |
| InChI | InChI=1S/C10H13BrN2O3/c1-16-8(14)4-7(13)9-5(11)2-3-6(12)10(9)15/h2-3,7,15H,4,12-13H2,1H3/t7-/m0/s1 |
| InChIKey | RUSISGINLBHTQT-ZETCQYMHSA-N |
| XLogP | 1.30 |
| TPSA | 98.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.13 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|