C11H11BrF3NO3 — CID 171255683
methyl (3S)-3-amino-3-[3-bromo-2-hydroxy-6-(trifluoromethyl)phenyl]propanoate (PubChem CID 171255683) has the molecular formula C11H11BrF3NO3 and a molecular weight of 342.11 g/mol. Its IUPAC name is methyl (3S)-3-amino-3-[3-bromo-2-hydroxy-6-(trifluoromethyl)phenyl]propanoate.
| Compound Name | methyl (3S)-3-amino-3-[3-bromo-2-hydroxy-6-(trifluoromethyl)phenyl]propanoate |
|---|---|
| PubChem CID | 171255683 |
| Molecular Formula | C11H11BrF3NO3 |
| Molecular Weight | 342.11 g/mol |
| Exact Mass | 340.99 |
| IUPAC Name | methyl (3S)-3-amino-3-[3-bromo-2-hydroxy-6-(trifluoromethyl)phenyl]propanoate |
| SMILES | COC(=O)C[C@H](N)c1c(C(F)(F)F)ccc(Br)c1O |
| InChI | InChI=1S/C11H11BrF3NO3/c1-19-8(17)4-7(16)9-5(11(13,14)15)2-3-6(12)10(9)18/h2-3,7,18H,4,16H2,1H3/t7-/m0/s1 |
| InChIKey | RKTBQJNFJHITMY-ZETCQYMHSA-N |
| XLogP | 2.74 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.11 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|