C13H15BrF3NO3 — CID 171259029
methyl (3S)-3-amino-3-[3-bromo-2-hydroxy-6-(trifluoromethyl)phenyl]-2,2-dimethylpropanoate (PubChem CID 171259029) has the molecular formula C13H15BrF3NO3 and a molecular weight of 370.17 g/mol. Its IUPAC name is methyl (3S)-3-amino-3-[3-bromo-2-hydroxy-6-(trifluoromethyl)phenyl]-2,2-dimethylpropanoate.
| Compound Name | methyl (3S)-3-amino-3-[3-bromo-2-hydroxy-6-(trifluoromethyl)phenyl]-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 171259029 |
| Molecular Formula | C13H15BrF3NO3 |
| Molecular Weight | 370.17 g/mol |
| Exact Mass | 369.02 |
| IUPAC Name | methyl (3S)-3-amino-3-[3-bromo-2-hydroxy-6-(trifluoromethyl)phenyl]-2,2-dimethylpropanoate |
| SMILES | COC(=O)C(C)(C)[C@@H](N)c1c(C(F)(F)F)ccc(Br)c1O |
| InChI | InChI=1S/C13H15BrF3NO3/c1-12(2,11(20)21-3)10(18)8-6(13(15,16)17)4-5-7(14)9(8)19/h4-5,10,19H,18H2,1-3H3/t10-/m0/s1 |
| InChIKey | PQFFBZGNUBYPNL-JTQLQIEISA-N |
| XLogP | 3.37 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.17 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|