C12H15BrFNO3 — CID 171256838
methyl (3R)-3-amino-3-(3-bromo-6-fluoro-2-hydroxyphenyl)-2,2-dimethylpropanoate (PubChem CID 171256838) has the molecular formula C12H15BrFNO3 and a molecular weight of 320.16 g/mol. Its IUPAC name is methyl (3R)-3-amino-3-(3-bromo-6-fluoro-2-hydroxyphenyl)-2,2-dimethylpropanoate.
| Compound Name | methyl (3R)-3-amino-3-(3-bromo-6-fluoro-2-hydroxyphenyl)-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 171256838 |
| Molecular Formula | C12H15BrFNO3 |
| Molecular Weight | 320.16 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | methyl (3R)-3-amino-3-(3-bromo-6-fluoro-2-hydroxyphenyl)-2,2-dimethylpropanoate |
| SMILES | COC(=O)C(C)(C)[C@@H](N)c1c(F)ccc(Br)c1O |
| InChI | InChI=1S/C12H15BrFNO3/c1-12(2,11(17)18-3)10(15)8-7(14)5-4-6(13)9(8)16/h4-5,10,16H,15H2,1-3H3/t10-/m0/s1 |
| InChIKey | UZRUKQXGLZGGMU-JTQLQIEISA-N |
| XLogP | 2.49 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.16 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|