C13H17BrClNO5 — CID 171256163
2-[(1R)-1-amino-3-methoxy-2,2-dimethyl-3-oxopropyl]-4-bromo-3-hydroxybenzoic acid;hydrochloride (PubChem CID 171256163) has the molecular formula C13H17BrClNO5 and a molecular weight of 382.64 g/mol. Its IUPAC name is 2-[(1R)-1-amino-3-methoxy-2,2-dimethyl-3-oxopropyl]-4-bromo-3-hydroxybenzoic acid;hydrochloride.
| Compound Name | 2-[(1R)-1-amino-3-methoxy-2,2-dimethyl-3-oxopropyl]-4-bromo-3-hydroxybenzoic acid;hydrochloride |
|---|---|
| PubChem CID | 171256163 |
| Molecular Formula | C13H17BrClNO5 |
| Molecular Weight | 382.64 g/mol |
| Exact Mass | 381.00 |
| IUPAC Name | 2-[(1R)-1-amino-3-methoxy-2,2-dimethyl-3-oxopropyl]-4-bromo-3-hydroxybenzoic acid;hydrochloride |
| SMILES | COC(=O)C(C)(C)[C@H](N)c1c(C(=O)O)ccc(Br)c1O.Cl |
| InChI | InChI=1S/C13H16BrNO5.ClH/c1-13(2,12(19)20-3)10(15)8-6(11(17)18)4-5-7(14)9(8)16;/h4-5,10,16H,15H2,1-3H3,(H,17,18);1H/t10-;/m1./s1 |
| InChIKey | UHEJTTQTFAAHFY-HNCPQSOCSA-N |
| XLogP | 2.47 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.64 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|