C12H14BrF2NO3 — CID 171254492
methyl (3S)-3-amino-3-(5-bromo-2,3-difluoro-6-hydroxyphenyl)-2,2-dimethylpropanoate (PubChem CID 171254492) has the molecular formula C12H14BrF2NO3 and a molecular weight of 338.15 g/mol. Its IUPAC name is methyl (3S)-3-amino-3-(5-bromo-2,3-difluoro-6-hydroxyphenyl)-2,2-dimethylpropanoate.
| Compound Name | methyl (3S)-3-amino-3-(5-bromo-2,3-difluoro-6-hydroxyphenyl)-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 171254492 |
| Molecular Formula | C12H14BrF2NO3 |
| Molecular Weight | 338.15 g/mol |
| Exact Mass | 337.01 |
| IUPAC Name | methyl (3S)-3-amino-3-(5-bromo-2,3-difluoro-6-hydroxyphenyl)-2,2-dimethylpropanoate |
| SMILES | COC(=O)C(C)(C)[C@H](N)c1c(O)c(Br)cc(F)c1F |
| InChI | InChI=1S/C12H14BrF2NO3/c1-12(2,11(18)19-3)10(16)7-8(15)6(14)4-5(13)9(7)17/h4,10,17H,16H2,1-3H3/t10-/m1/s1 |
| InChIKey | PLHYVPLNDZCTHM-SNVBAGLBSA-N |
| XLogP | 2.63 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.15 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|