C8H8Br2FNO — CID 130822566
2-[(1S)-1-amino-2-fluoroethyl]-3,6-dibromophenol (PubChem CID 130822566) has the molecular formula C8H8Br2FNO and a molecular weight of 312.96 g/mol. Its IUPAC name is 2-[(1S)-1-amino-2-fluoroethyl]-3,6-dibromophenol.
| Compound Name | 2-[(1S)-1-amino-2-fluoroethyl]-3,6-dibromophenol |
|---|---|
| PubChem CID | 130822566 |
| Molecular Formula | C8H8Br2FNO |
| Molecular Weight | 312.96 g/mol |
| Exact Mass | 310.90 |
| IUPAC Name | 2-[(1S)-1-amino-2-fluoroethyl]-3,6-dibromophenol |
| SMILES | N[C@H](CF)c1c(Br)ccc(Br)c1O |
| InChI | InChI=1S/C8H8Br2FNO/c9-4-1-2-5(10)8(13)7(4)6(12)3-11/h1-2,6,13H,3,12H2/t6-/m1/s1 |
| InChIKey | QDEZHVGVMGLPLB-ZCFIWIBFSA-N |
| XLogP | 2.89 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.96 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|