C12H10BrNO3S — CID 171254642
3-[(R)-amino(thiophen-2-yl)methyl]-4-bromo-2-hydroxybenzoic acid (PubChem CID 171254642) has the molecular formula C12H10BrNO3S and a molecular weight of 328.19 g/mol. Its IUPAC name is 3-[(R)-amino(thiophen-2-yl)methyl]-4-bromo-2-hydroxybenzoic acid.
| Compound Name | 3-[(R)-amino(thiophen-2-yl)methyl]-4-bromo-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 171254642 |
| Molecular Formula | C12H10BrNO3S |
| Molecular Weight | 328.19 g/mol |
| Exact Mass | 326.96 |
| IUPAC Name | 3-[(R)-amino(thiophen-2-yl)methyl]-4-bromo-2-hydroxybenzoic acid |
| SMILES | N[C@@H](c1cccs1)c1c(Br)ccc(C(=O)O)c1O |
| InChI | InChI=1S/C12H10BrNO3S/c13-7-4-3-6(12(16)17)11(15)9(7)10(14)8-2-1-5-18-8/h1-5,10,15H,14H2,(H,16,17)/t10-/m0/s1 |
| InChIKey | JDXJHGKBAAKZMI-JTQLQIEISA-N |
| XLogP | 2.96 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.19 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|