C12H17BrClNO4 — CID 171257996
3-[(1R)-1-amino-3-hydroxy-2,2-dimethylpropyl]-4-bromo-2-hydroxybenzoic acid;hydrochloride (PubChem CID 171257996) has the molecular formula C12H17BrClNO4 and a molecular weight of 354.63 g/mol. Its IUPAC name is 3-[(1R)-1-amino-3-hydroxy-2,2-dimethylpropyl]-4-bromo-2-hydroxybenzoic acid;hydrochloride.
| Compound Name | 3-[(1R)-1-amino-3-hydroxy-2,2-dimethylpropyl]-4-bromo-2-hydroxybenzoic acid;hydrochloride |
|---|---|
| PubChem CID | 171257996 |
| Molecular Formula | C12H17BrClNO4 |
| Molecular Weight | 354.63 g/mol |
| Exact Mass | 353.00 |
| IUPAC Name | 3-[(1R)-1-amino-3-hydroxy-2,2-dimethylpropyl]-4-bromo-2-hydroxybenzoic acid;hydrochloride |
| SMILES | CC(C)(CO)[C@@H](N)c1c(Br)ccc(C(=O)O)c1O.Cl |
| InChI | InChI=1S/C12H16BrNO4.ClH/c1-12(2,5-15)10(14)8-7(13)4-3-6(9(8)16)11(17)18;/h3-4,10,15-16H,5,14H2,1-2H3,(H,17,18);1H/t10-;/m0./s1 |
| InChIKey | BRIZEKSDHBQKDY-PPHPATTJSA-N |
| XLogP | 2.29 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.63 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|