About 3-bromo-2,4-dihydroxybenzoic acid
3-bromo-2,4-dihydroxybenzoic acid (PubChem CID 90007527) has the molecular formula C7H5BrO4
and a molecular weight of 233.02 g/mol. Its IUPAC name is 3-bromo-2,4-dihydroxybenzoic acid.
Molecular Properties
| Compound Name | 3-bromo-2,4-dihydroxybenzoic acid |
| PubChem CID | 90007527 |
| Molecular Formula | C7H5BrO4 |
| Molecular Weight | 233.02 g/mol |
| Exact Mass | 231.94 |
| IUPAC Name | 3-bromo-2,4-dihydroxybenzoic acid |
| SMILES | O=C(O)c1ccc(O)c(Br)c1O |
| InChI | InChI=1S/C7H5BrO4/c8-5-4(9)2-1-3(6(5)10)7(11)12/h1-2,9-10H,(H,11,12) |
| InChIKey | MMGBAAQRBGRLLA-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.02 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-bromo-2,4-dihydroxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-2,4-dihydroxybenzoic acid?
The IUPAC name of 3-bromo-2,4-dihydroxybenzoic acid (CID 90007527) is 3-bromo-2,4-dihydroxybenzoic acid.
What is the SMILES notation for 3-bromo-2,4-dihydroxybenzoic acid?
The canonical SMILES for 3-bromo-2,4-dihydroxybenzoic acid is O=C(O)c1ccc(O)c(Br)c1O.
What is the InChIKey of 3-bromo-2,4-dihydroxybenzoic acid?
The InChIKey is MMGBAAQRBGRLLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5BrO4/c8-5-4(9)2-1-3(6(5)10)7(11)12/h1-2,9-10H,(H,11,12).
What are the key properties of 3-bromo-2,4-dihydroxybenzoic acid?
3-bromo-2,4-dihydroxybenzoic acid has a molecular weight of 233.02 g/mol, XLogP of 1.56, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-2,4-dihydroxybenzoic acid is sourced from PubChem (CID 90007527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).