C11H9Br3O3 — CID 87506053
(2,3,4-tribromophenyl) 2-methylidenebutaneperoxoate (PubChem CID 87506053) has the molecular formula C11H9Br3O3 and a molecular weight of 428.90 g/mol. Its IUPAC name is (2,3,4-tribromophenyl) 2-methylidenebutaneperoxoate.
| Compound Name | (2,3,4-tribromophenyl) 2-methylidenebutaneperoxoate |
|---|---|
| PubChem CID | 87506053 |
| Molecular Formula | C11H9Br3O3 |
| Molecular Weight | 428.90 g/mol |
| Exact Mass | 425.81 |
| IUPAC Name | (2,3,4-tribromophenyl) 2-methylidenebutaneperoxoate |
| SMILES | C=C(CC)C(=O)OOc1ccc(Br)c(Br)c1Br |
| InChI | InChI=1S/C11H9Br3O3/c1-3-6(2)11(15)17-16-8-5-4-7(12)9(13)10(8)14/h4-5H,2-3H2,1H3 |
| InChIKey | GFSJLAWXQZJJTG-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.90 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|