About dibromo-ethoxy-(2,3,4-tribromophenoxy)silane
dibromo-ethoxy-(2,3,4-tribromophenoxy)silane (PubChem CID 150127406) has the molecular formula C8H7Br5O2Si
and a molecular weight of 562.75 g/mol. Its IUPAC name is dibromo-ethoxy-(2,3,4-tribromophenoxy)silane.
Molecular Properties
| Compound Name | dibromo-ethoxy-(2,3,4-tribromophenoxy)silane |
| PubChem CID | 150127406 |
| Molecular Formula | C8H7Br5O2Si |
| Molecular Weight | 562.75 g/mol |
| Exact Mass | 557.61 |
| IUPAC Name | dibromo-ethoxy-(2,3,4-tribromophenoxy)silane |
| SMILES | CCO[Si](Br)(Br)Oc1ccc(Br)c(Br)c1Br |
| InChI | InChI=1S/C8H7Br5O2Si/c1-2-14-16(12,13)15-6-4-3-5(9)7(10)8(6)11/h3-4H,2H2,1H3 |
| InChIKey | FANCRYWIVOSZNL-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 562.75 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze dibromo-ethoxy-(2,3,4-tribromophenoxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibromo-ethoxy-(2,3,4-tribromophenoxy)silane?
The IUPAC name of dibromo-ethoxy-(2,3,4-tribromophenoxy)silane (CID 150127406) is dibromo-ethoxy-(2,3,4-tribromophenoxy)silane.
What is the SMILES notation for dibromo-ethoxy-(2,3,4-tribromophenoxy)silane?
The canonical SMILES for dibromo-ethoxy-(2,3,4-tribromophenoxy)silane is CCO[Si](Br)(Br)Oc1ccc(Br)c(Br)c1Br.
What is the InChIKey of dibromo-ethoxy-(2,3,4-tribromophenoxy)silane?
The InChIKey is FANCRYWIVOSZNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7Br5O2Si/c1-2-14-16(12,13)15-6-4-3-5(9)7(10)8(6)11/h3-4H,2H2,1H3.
What are the key properties of dibromo-ethoxy-(2,3,4-tribromophenoxy)silane?
dibromo-ethoxy-(2,3,4-tribromophenoxy)silane has a molecular weight of 562.75 g/mol, XLogP of 5.61, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dibromo-ethoxy-(2,3,4-tribromophenoxy)silane is sourced from PubChem (CID 150127406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).