C8H7Br5O2Si — CID 150127406
dibromo-ethoxy-(2,3,4-tribromophenoxy)silane (PubChem CID 150127406) has the molecular formula C8H7Br5O2Si and a molecular weight of 562.75 g/mol. Its IUPAC name is dibromo-ethoxy-(2,3,4-tribromophenoxy)silane.
| Compound Name | dibromo-ethoxy-(2,3,4-tribromophenoxy)silane |
|---|---|
| PubChem CID | 150127406 |
| Molecular Formula | C8H7Br5O2Si |
| Molecular Weight | 562.75 g/mol |
| Exact Mass | 557.61 |
| IUPAC Name | dibromo-ethoxy-(2,3,4-tribromophenoxy)silane |
| SMILES | CCO[Si](Br)(Br)Oc1ccc(Br)c(Br)c1Br |
| InChI | InChI=1S/C8H7Br5O2Si/c1-2-14-16(12,13)15-6-4-3-5(9)7(10)8(6)11/h3-4H,2H2,1H3 |
| InChIKey | FANCRYWIVOSZNL-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.75 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|