C23H20O3 — CID 87642475
(2,6-diphenylphenyl) 2-methylidenebutaneperoxoate (PubChem CID 87642475) has the molecular formula C23H20O3 and a molecular weight of 344.41 g/mol. Its IUPAC name is (2,6-diphenylphenyl) 2-methylidenebutaneperoxoate.
| Compound Name | (2,6-diphenylphenyl) 2-methylidenebutaneperoxoate |
|---|---|
| PubChem CID | 87642475 |
| Molecular Formula | C23H20O3 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | (2,6-diphenylphenyl) 2-methylidenebutaneperoxoate |
| SMILES | C=C(CC)C(=O)OOc1c(-c2ccccc2)cccc1-c1ccccc1 |
| InChI | InChI=1S/C23H20O3/c1-3-17(2)23(24)26-25-22-20(18-11-6-4-7-12-18)15-10-16-21(22)19-13-8-5-9-14-19/h4-16H,2-3H2,1H3 |
| InChIKey | TZADTEWJLNAQSL-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|