C19H16O — CID 23524590
2-methoxy-1,3-diphenylbenzene (PubChem CID 23524590) has the molecular formula C19H16O and a molecular weight of 260.34 g/mol. Its IUPAC name is 2-methoxy-1,3-diphenylbenzene.
| Compound Name | 2-methoxy-1,3-diphenylbenzene |
|---|---|
| PubChem CID | 23524590 |
| Molecular Formula | C19H16O |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 2-methoxy-1,3-diphenylbenzene |
| SMILES | COc1c(-c2ccccc2)cccc1-c1ccccc1 |
| InChI | InChI=1S/C19H16O/c1-20-19-17(15-9-4-2-5-10-15)13-8-14-18(19)16-11-6-3-7-12-16/h2-14H,1H3 |
| InChIKey | GZPSSLBABVRXFT-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |