C11H9Br2IO — CID 139754248
1,3-dibromo-4-cyclopent-2-en-1-yloxy-2-iodobenzene (PubChem CID 139754248) has the molecular formula C11H9Br2IO and a molecular weight of 443.90 g/mol. Its IUPAC name is 1,3-dibromo-4-cyclopent-2-en-1-yloxy-2-iodobenzene.
| Compound Name | 1,3-dibromo-4-cyclopent-2-en-1-yloxy-2-iodobenzene |
|---|---|
| PubChem CID | 139754248 |
| Molecular Formula | C11H9Br2IO |
| Molecular Weight | 443.90 g/mol |
| Exact Mass | 441.81 |
| IUPAC Name | 1,3-dibromo-4-cyclopent-2-en-1-yloxy-2-iodobenzene |
| SMILES | Brc1ccc(OC2C=CCC2)c(Br)c1I |
| InChI | InChI=1S/C11H9Br2IO/c12-8-5-6-9(10(13)11(8)14)15-7-3-1-2-4-7/h1,3,5-7H,2,4H2 |
| InChIKey | OUSBMDGNWAGRPU-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.90 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|