C13H14O3 — CID 105472168
4-cyclopent-2-en-1-yloxy-3-methoxybenzaldehyde (PubChem CID 105472168) has the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. Its IUPAC name is 4-cyclopent-2-en-1-yloxy-3-methoxybenzaldehyde.
| Compound Name | 4-cyclopent-2-en-1-yloxy-3-methoxybenzaldehyde |
|---|---|
| PubChem CID | 105472168 |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 4-cyclopent-2-en-1-yloxy-3-methoxybenzaldehyde |
| SMILES | COc1cc(C=O)ccc1OC1C=CCC1 |
| InChI | InChI=1S/C13H14O3/c1-15-13-8-10(9-14)6-7-12(13)16-11-4-2-3-5-11/h2,4,6-9,11H,3,5H2,1H3 |
| InChIKey | QHYSUKRQSCGRRE-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|