C15H15BrO3 — CID 170440966
4-(4-bromo-6-methylcyclohexa-2,4-dien-1-yl)oxy-3-methoxybenzaldehyde (PubChem CID 170440966) has the molecular formula C15H15BrO3 and a molecular weight of 323.19 g/mol. Its IUPAC name is 4-(4-bromo-6-methylcyclohexa-2,4-dien-1-yl)oxy-3-methoxybenzaldehyde.
| Compound Name | 4-(4-bromo-6-methylcyclohexa-2,4-dien-1-yl)oxy-3-methoxybenzaldehyde |
|---|---|
| PubChem CID | 170440966 |
| Molecular Formula | C15H15BrO3 |
| Molecular Weight | 323.19 g/mol |
| Exact Mass | 322.02 |
| IUPAC Name | 4-(4-bromo-6-methylcyclohexa-2,4-dien-1-yl)oxy-3-methoxybenzaldehyde |
| SMILES | COc1cc(C=O)ccc1OC1C=CC(Br)=CC1C |
| InChI | InChI=1S/C15H15BrO3/c1-10-7-12(16)4-6-13(10)19-14-5-3-11(9-17)8-15(14)18-2/h3-10,13H,1-2H3 |
| InChIKey | UPOTVULILYAFFO-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.19 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|